4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine
![4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine Structure](https://image.chemsrc.com/caspic/046/135489-07-5.png)
4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine structure
|
Common Name | 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine | ||
|---|---|---|---|---|
| CAS Number | 135489-07-5 | Molecular Weight | 274.77400 | |
| Density | 1.81g/cm3 | Boiling Point | 409.9ºC at 760mmHg | |
| Molecular Formula | C7H3ClN4S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.81g/cm3 |
|---|---|
| Boiling Point | 409.9ºC at 760mmHg |
| Molecular Formula | C7H3ClN4S3 |
| Molecular Weight | 274.77400 |
| Flash Point | 201.7ºC |
| Exact Mass | 273.92100 |
| PSA | 133.34000 |
| LogP | 3.07130 |
| Vapour Pressure | 1.49E-06mmHg at 25°C |
| Index of Refraction | 1.836 |
| InChIKey | LIJPIIZMXUSVQH-UHFFFAOYSA-N |
| SMILES | CSc1nsc2sc3c(Cl)nnnc3c12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~68%
4-chloro-8-meth... CAS#:135489-07-5 |
| Literature: Guerrera; Sarva; Siracusa; Caruso; Leone; Cutuli; Oliveri Farmaco, 1991 , vol. 46, # 1 p. 33 - 44 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Isothiazolo(4',5':4,5)thieno(3,2-d)-1,2,3-triazine,4-chloro-8-(methylthio) |
| 4-Chloro-8-(methylthio)isothiazolo(4',5':4,5)thieno(3,2-d)-1,2,3-triazine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine? |
| A: The English name of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine is 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine. |
| Q: What is the polar surface area (PSA) of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine? |
| A: Polar surface area (PSA) of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine is 133.34000. |
| Q: What is the boiling point of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine? |
| A: Boiling point of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine is 409.9ºC at 760mmHg. |
| Q: What are the upstream materials of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine? |
| A: Related upstream materials(CAS) of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine: 72436-92-1. |
| Q: What is the CAS number of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine? |
| A: CAS number of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine is 135489-07-5. |
| Q: What is the molecular weight of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine? |
| A: Molecular weight of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine is 274.77400. |
| Q: What is the Chinese name of 135489-07-5? |
| A: Chinese name of 135489-07-5 is 135489-07-5. |
| Q: What English synonyms does 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine have? |
| A: English synonyms of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine: Isothiazolo(4',5':4,5)thieno(3,2-d)-1,2,3-triazine,4-chloro-8-(methylthio), 4-Chloro-8-(methylthio)isothiazolo(4',5':4,5)thieno(3,2-d)-1,2,3-triazine. |
| Q: What is the InChIKey of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine? |
| A: InChIKey of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine is LIJPIIZMXUSVQH-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine? |
| A: SMILES notation of 4-chloro-8-methylsulfanyl-[1,2]thiazolo[2,3]thieno[2,4-b]triazine is CSc1nsc2sc3c(Cl)nnnc3c12. |