7,10-bis(2,2-dibromoethenyl)fluoranthene structure
|
Common Name | 7,10-bis(2,2-dibromoethenyl)fluoranthene | ||
|---|---|---|---|---|
| CAS Number | 135584-70-2 | Molecular Weight | 569.90900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H10Br4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7,10-bis(2,2-dibromoethenyl)fluoranthene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H10Br4 |
|---|---|
| Molecular Weight | 569.90900 |
| Exact Mass | 565.75200 |
| LogP | 8.66360 |
| InChIKey | IEEWXRWFYNETGT-UHFFFAOYSA-N |
| SMILES | BrC(Br)=Cc1ccc(C=C(Br)Br)c2c1-c1cccc3cccc-2c13 |
|
~59%
7,10-bis(2,2-di... CAS#:135584-70-2 |
| Literature: Scott, Lawrence T.; Cheng, Pei-Chao; Hashemi, Mohammed M.; Bratcher, Matthew S.; Meyer, Dayton T.; Warren, Hope B. Journal of the American Chemical Society, 1997 , vol. 119, # 45 p. 10963 - 10968 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Fluoranthene,7,10-bis(2,2-dibromoethenyl) |