Cinobufagin metabolite M-1
Modify Date: 2025-08-29 17:17:03
Cinobufagin metabolite M-1 structure
|
Common Name | Cinobufagin metabolite M-1 | ||
|---|---|---|---|---|
| CAS Number | 1357380-54-1 | Molecular Weight | 458.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H34O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Cinobufagin metabolite M-1 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H34O7 |
|---|---|
| Molecular Weight | 458.5 |
| InChIKey | LSTXJZUCJIEQDL-VTBFSACKSA-N |
| SMILES | CC(=O)OC1C(c2ccc(=O)oc2)C2(C)CCC3C(CCC4CC(O)CC(O)C43C)C23OC13 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 15, Current Page 1 of 2
1
2
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Cinobufagin metabolite M-1? |
| A: CAS number of Cinobufagin metabolite M-1 is 1357380-54-1. |
| Q: What is the molecular formula of Cinobufagin metabolite M-1? |
| A: Molecular formula of Cinobufagin metabolite M-1 is C26H34O7. |
| Q: What is the molecular weight of Cinobufagin metabolite M-1? |
| A: Molecular weight of Cinobufagin metabolite M-1 is 458.5. |
| Q: What is the Chinese name of 1357380-54-1? |
| A: Chinese name of 1357380-54-1 is 1357380-54-1. |
| Q: What is the SMILES notation of Cinobufagin metabolite M-1? |
| A: SMILES notation of Cinobufagin metabolite M-1 is CC(=O)OC1C(c2ccc(=O)oc2)C2(C)CCC3C(CCC4CC(O)CC(O)C43C)C23OC13. |
| Q: What is the InChIKey of Cinobufagin metabolite M-1? |
| A: InChIKey of Cinobufagin metabolite M-1 is LSTXJZUCJIEQDL-VTBFSACKSA-N. |
| Q: What is the English name of Cinobufagin metabolite M-1? |
| A: The English name of Cinobufagin metabolite M-1 is Cinobufagin metabolite M-1. |