N,3-dimethoxy-N,4-dimethylbenzamide
Modify Date: 2025-08-23 11:54:23
N,3-dimethoxy-N,4-dimethylbenzamide structure
|
Common Name | N,3-dimethoxy-N,4-dimethylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 135754-83-5 | Molecular Weight | 209.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,3-dimethoxy-N,4-dimethylbenzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15NO3 |
|---|---|
| Molecular Weight | 209.24 |
| InChIKey | PGZUZUQIHWXJFJ-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)N(C)OC)ccc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N,3-dimethoxy-N,4-dimethylbenzamide? |
| A: The English name of N,3-dimethoxy-N,4-dimethylbenzamide is N,3-dimethoxy-N,4-dimethylbenzamide. |
| Q: What is the Chinese name of 135754-83-5? |
| A: Chinese name of 135754-83-5 is 135754-83-5. |
| Q: What is the InChIKey of N,3-dimethoxy-N,4-dimethylbenzamide? |
| A: InChIKey of N,3-dimethoxy-N,4-dimethylbenzamide is PGZUZUQIHWXJFJ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N,3-dimethoxy-N,4-dimethylbenzamide? |
| A: Molecular formula of N,3-dimethoxy-N,4-dimethylbenzamide is C11H15NO3. |
| Q: What is the CAS number of N,3-dimethoxy-N,4-dimethylbenzamide? |
| A: CAS number of N,3-dimethoxy-N,4-dimethylbenzamide is 135754-83-5. |
| Q: What is the SMILES notation of N,3-dimethoxy-N,4-dimethylbenzamide? |
| A: SMILES notation of N,3-dimethoxy-N,4-dimethylbenzamide is COc1cc(C(=O)N(C)OC)ccc1C. |
| Q: What is the molecular weight of N,3-dimethoxy-N,4-dimethylbenzamide? |
| A: Molecular weight of N,3-dimethoxy-N,4-dimethylbenzamide is 209.24. |