Benzenepropanoic acid,4-methoxy-3-[3-(4-methoxyphenyl)-1-oxopropyl]- structure
|
Common Name | Benzenepropanoic acid,4-methoxy-3-[3-(4-methoxyphenyl)-1-oxopropyl]- | ||
|---|---|---|---|---|
| CAS Number | 13577-08-7 | Molecular Weight | 342.38600 | |
| Density | 1.18g/cm3 | Boiling Point | 554.1ºC at 760mmHg | |
| Molecular Formula | C20H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.6ºC | |
| Name | 3-[4-methoxy-3-[3-(4-methoxyphenyl)propanoyl]phenyl]propanoic acid |
|---|
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 554.1ºC at 760mmHg |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.38600 |
| Flash Point | 196.6ºC |
| Exact Mass | 342.14700 |
| PSA | 72.83000 |
| LogP | 3.53650 |
| Vapour Pressure | 4.12E-13mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | RYQBCYLFAYJFIF-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCC(=O)c2cc(CCC(=O)O)ccc2OC)cc1 |
| HS Code | 2918990090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |