Isoquinoline, 3-chloro-7-(trifluoromethyl)
Modify Date: 2026-08-09 17:44:12
Isoquinoline, 3-chloro-7-(trifluoromethyl) structure
|
Common Name | Isoquinoline, 3-chloro-7-(trifluoromethyl) | ||
|---|---|---|---|---|
| CAS Number | 1357946-00-9 | Molecular Weight | 231.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H5ClF3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Isoquinoline, 3-chloro-7-(trifluoromethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H5ClF3N |
|---|---|
| Molecular Weight | 231.60 |
| InChIKey | KTDKHPDVFGRCIY-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc2cc(Cl)ncc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Isoquinoline, 3-chloro-7-(trifluoromethyl)? |
| A: Molecular weight of Isoquinoline, 3-chloro-7-(trifluoromethyl) is 231.60. |
| Q: What is the Chinese name of 1357946-00-9? |
| A: Chinese name of 1357946-00-9 is 1357946-00-9. |
| Q: What is the InChIKey of Isoquinoline, 3-chloro-7-(trifluoromethyl)? |
| A: InChIKey of Isoquinoline, 3-chloro-7-(trifluoromethyl) is KTDKHPDVFGRCIY-UHFFFAOYSA-N. |
| Q: What is the English name of Isoquinoline, 3-chloro-7-(trifluoromethyl)? |
| A: The English name of Isoquinoline, 3-chloro-7-(trifluoromethyl) is Isoquinoline, 3-chloro-7-(trifluoromethyl). |
| Q: What is the molecular formula of Isoquinoline, 3-chloro-7-(trifluoromethyl)? |
| A: Molecular formula of Isoquinoline, 3-chloro-7-(trifluoromethyl) is C10H5ClF3N. |
| Q: What is the CAS number of Isoquinoline, 3-chloro-7-(trifluoromethyl)? |
| A: CAS number of Isoquinoline, 3-chloro-7-(trifluoromethyl) is 1357946-00-9. |
| Q: What is the SMILES notation of Isoquinoline, 3-chloro-7-(trifluoromethyl)? |
| A: SMILES notation of Isoquinoline, 3-chloro-7-(trifluoromethyl) is FC(F)(F)c1ccc2cc(Cl)ncc2c1. |