N-cyclopropyl-4-fluoro-2-nitro-5-piperazin-1-ylaniline structure
|
Common Name | N-cyclopropyl-4-fluoro-2-nitro-5-piperazin-1-ylaniline | ||
|---|---|---|---|---|
| CAS Number | 135861-05-1 | Molecular Weight | 280.29800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17FN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-cyclopropyl-4-fluoro-2-nitro-5-piperazin-1-ylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H17FN4O2 |
|---|---|
| Molecular Weight | 280.29800 |
| Exact Mass | 280.13400 |
| PSA | 73.12000 |
| LogP | 2.70780 |
| InChIKey | AARASCRJLBECJY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(F)c(N2CCNCC2)cc1NC1CC1 |
|
~85%
N-cyclopropyl-4... CAS#:135861-05-1 |
| Literature: Hubschwerlen; Pflieger; Specklin; Gubernator; Gmunder; Angehrn; Kompis Journal of Medicinal Chemistry, 1992 , vol. 35, # 8 p. 1385 - 1392 |
|
~%
N-cyclopropyl-4... CAS#:135861-05-1 |
| Literature: Hubschwerlen; Pflieger; Specklin; Gubernator; Gmunder; Angehrn; Kompis Journal of Medicinal Chemistry, 1992 , vol. 35, # 8 p. 1385 - 1392 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| N-Cyclopropyl-4-fluoro-6-nitro-3-piperazinylaniline |
| Benzenamine,N-cyclopropyl-4-fluoro-2-nitro-5-(1-piperazinyl) |
| 4-<5-cyclopropylamino)-2-fluoro-4-nitrophenyl>piperazine |