diethyl quinoxalin-2-yl phosphate structure
|
Common Name | diethyl quinoxalin-2-yl phosphate | ||
|---|---|---|---|---|
| CAS Number | 13593-09-4 | Molecular Weight | 282.23200 | |
| Density | 1.28g/cm3 | Boiling Point | 369.2ºC at 760 mmHg | |
| Molecular Formula | C12H15N2O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.1ºC | |
| Name | diethyl quinoxalin-2-yl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 369.2ºC at 760 mmHg |
| Molecular Formula | C12H15N2O4P |
| Molecular Weight | 282.23200 |
| Flash Point | 177.1ºC |
| Exact Mass | 282.07700 |
| PSA | 80.35000 |
| LogP | 3.18970 |
| Vapour Pressure | 2.57E-05mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | GBTNLVQIMKRHOM-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)Oc1cnc2ccccc2n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Phosphoric acid,diethyl 2-quinoxalinyl ester |
| 2-diethoxyphosphoryloxyquinoxaline |
| Diethyl 2-quinoxalinyl phosphate |