2,6-Diazaspiro[3.3]heptane, 2,6-bis[(4-Methylphenyl)sulfonyl]- structure
|
Common Name | 2,6-Diazaspiro[3.3]heptane, 2,6-bis[(4-Methylphenyl)sulfonyl]- | ||
|---|---|---|---|---|
| CAS Number | 13595-48-7 | Molecular Weight | 406.51900 | |
| Density | 1.46g/cm3 | Boiling Point | 586ºC at 760 mmHg | |
| Molecular Formula | C19H22N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.2ºC | |
| Name | 2,6-bis-(4-methylphenyl)sulfonyl-2,6-diazaspiro[3.3]heptane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 586ºC at 760 mmHg |
| Molecular Formula | C19H22N2O4S2 |
| Molecular Weight | 406.51900 |
| Flash Point | 308.2ºC |
| Exact Mass | 406.10200 |
| PSA | 91.52000 |
| LogP | 4.03600 |
| Vapour Pressure | 1.03E-13mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | SSBYIOBPVGLYQB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3(C2)CN(S(=O)(=O)c2ccc(C)cc2)C3)cc1 |
| HS Code | 2933990090 |
|---|
|
~%
2,6-Diazaspiro[... CAS#:13595-48-7 |
| Literature: Litherland; Mann Journal of the Chemical Society, 1938 , p. 1588,1593 |
|
~%
2,6-Diazaspiro[... CAS#:13595-48-7 |
| Literature: Govaert; Beyaert Bulletin des Societes Chimiques Belges, 1946 , vol. 55, p. 106,114 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5,6-trichloro-3-trifluoromethylpyridine |
| s05-0175 |