pentakisphosphorus nitride dichloride
Modify Date: 2026-08-02 13:24:57
pentakisphosphorus nitride dichloride structure
|
Common Name | pentakisphosphorus nitride dichloride | ||
|---|---|---|---|---|
| CAS Number | 13596-41-3 | Molecular Weight | 579.43200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | Cl10N5P5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | pentakisphosphorus nitride dichloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | Cl10N5P5 |
|---|---|
| Molecular Weight | 579.43200 |
| Exact Mass | 574.57300 |
| PSA | 110.85000 |
| LogP | 9.29700 |
| InChIKey | RCOADBCSRMTGFG-UHFFFAOYSA-N |
| SMILES | ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| phosphonitrile dichloride cyclic pentamer |
| Pentakisphosphornitriddichlorid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of pentakisphosphorus nitride dichloride? |
| A: Polar surface area (PSA) of pentakisphosphorus nitride dichloride is 110.85000. |
| Q: What is the molecular formula of pentakisphosphorus nitride dichloride? |
| A: Molecular formula of pentakisphosphorus nitride dichloride is Cl10N5P5. |
| Q: What is the SMILES notation of pentakisphosphorus nitride dichloride? |
| A: SMILES notation of pentakisphosphorus nitride dichloride is ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1. |
| Q: What English synonyms does pentakisphosphorus nitride dichloride have? |
| A: English synonyms of pentakisphosphorus nitride dichloride: phosphonitrile dichloride cyclic pentamer, Pentakisphosphornitriddichlorid. |
| Q: What is the English name of pentakisphosphorus nitride dichloride? |
| A: The English name of pentakisphosphorus nitride dichloride is pentakisphosphorus nitride dichloride. |
| Q: What is the InChIKey of pentakisphosphorus nitride dichloride? |
| A: InChIKey of pentakisphosphorus nitride dichloride is RCOADBCSRMTGFG-UHFFFAOYSA-N. |
| Q: What is the CAS number of pentakisphosphorus nitride dichloride? |
| A: CAS number of pentakisphosphorus nitride dichloride is 13596-41-3. |
| Q: What is the LogP of pentakisphosphorus nitride dichloride? |
| A: LogP of pentakisphosphorus nitride dichloride is 9.29700. |
| Q: What is the molecular weight of pentakisphosphorus nitride dichloride? |
| A: Molecular weight of pentakisphosphorus nitride dichloride is 579.43200. |
| Q: What is the Chinese name of 13596-41-3? |
| A: Chinese name of 13596-41-3 is 13596-41-3. |