N-Methylcarbanilic acid phenyl ester structure
|
Common Name | N-Methylcarbanilic acid phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 13599-69-4 | Molecular Weight | 227.25900 | |
| Density | 1.177g/cm3 | Boiling Point | 330.6ºC at 760 mmHg | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.7ºC | |
| Name | phenyl N-methyl-N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.177g/cm3 |
|---|---|
| Boiling Point | 330.6ºC at 760 mmHg |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.25900 |
| Flash Point | 153.7ºC |
| Exact Mass | 227.09500 |
| PSA | 29.54000 |
| LogP | 3.32180 |
| Vapour Pressure | 0.000165mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | XMKAIGDUODXFEL-UHFFFAOYSA-N |
| SMILES | CN(C(=O)Oc1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Methyl-N-phenyl-carbamidsaeure-phenylester |
| phenyl methyl(phenyl)carbamate |
| methyl-phenyl-carbamic acid phenyl ester |
| Phenyl methylphenylcarbamic acid |
| Methyl-phenyl-carbamidsaeure-phenylester |
| N-Methyl-carbanilsaeure-phenylester |
| Phenyl-N-methyl-N-phenylcarbamat |
| Carbamic acid,methylphenyl-,phenyl ester |