(beta-,4-dihydroxyphenethyl)methylammonium hydrogen [R-(R*,R*)]-tartrate structure
|
Common Name | (beta-,4-dihydroxyphenethyl)methylammonium hydrogen [R-(R*,R*)]-tartrate | ||
|---|---|---|---|---|
| CAS Number | 136-38-9 | Molecular Weight | 317.29200 | |
| Density | N/A | Boiling Point | 341.1ºC at 760 mmHg | |
| Molecular Formula | C13H19NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.4ºC | |
| Name | (2R,3R)-2,3-dihydroxybutanedioic acid,4-[1-hydroxy-2-(methylamino)ethyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 341.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H19NO8 |
| Molecular Weight | 317.29200 |
| Flash Point | 163.4ºC |
| Exact Mass | 317.11100 |
| PSA | 174.96000 |
| Vapour Pressure | 3.18E-05mmHg at 25°C |
| InChIKey | GOVGCYCBKCCFIR-LREBCSMRSA-N |
| SMILES | CNCC(O)c1ccc(O)cc1.O=C(O)C(O)C(O)C(=O)O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| d,l-Synephrine tartrate |
| EINECS 205-242-2 |
| synephrine tartrate |