1-Phenanthrenecarboxaldehyd structure
|
Common Name | 1-Phenanthrenecarboxaldehyd | ||
|---|---|---|---|---|
| CAS Number | 13601-88-2 | Molecular Weight | 284.43600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H28O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 1-PhenanthrenecarboxaldehydDehydroabietal is a natural product found in Pinus brutia var. eldarica, Cedrus atlantica and other organisms[1]. |
| Name | dehydroabietadienal |
|---|
| Description | Dehydroabietal is a natural product found in Pinus brutia var. eldarica, Cedrus atlantica and other organisms[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H28O |
|---|---|
| Molecular Weight | 284.43600 |
| Exact Mass | 284.21400 |
| PSA | 17.07000 |
| LogP | 5.01920 |
| InChIKey | YCLCHPWRGSDZKL-SLFFLAALSA-N |
| SMILES | CC(C)c1ccc2c(c1)CCC1C(C)(C=O)CCCC21C |