4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one
Modify Date: 2026-08-25 01:02:56
4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one structure
|
Common Name | 4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one | ||
|---|---|---|---|---|
| CAS Number | 1360900-66-8 | Molecular Weight | 266.01 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H3BrF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H3BrF3NO |
|---|---|
| Molecular Weight | 266.01 |
| InChIKey | YKADIYYBYAKWPP-UHFFFAOYSA-N |
| SMILES | O=C1Nc2c(F)ccc(Br)c2C1(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one? |
| A: Molecular formula of 4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one is C8H3BrF3NO. |
| Q: What is the SMILES notation of 4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one? |
| A: SMILES notation of 4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one is O=C1Nc2c(F)ccc(Br)c2C1(F)F. |
| Q: What is the InChIKey of 4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one? |
| A: InChIKey of 4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one is YKADIYYBYAKWPP-UHFFFAOYSA-N. |
| Q: What is the English name of 4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one? |
| A: The English name of 4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one is 4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one. |
| Q: What is the molecular weight of 4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one? |
| A: Molecular weight of 4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one is 266.01. |
| Q: What is the Chinese name of 1360900-66-8? |
| A: Chinese name of 1360900-66-8 is 1360900-66-8. |
| Q: What is the CAS number of 4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one? |
| A: CAS number of 4-bromo-3,3,7-trifluoro-1,3-dihydro-2H-indol-2-one is 1360900-66-8. |