4-{5-[2-(4-Fluoro-phenoxy)-ethyl]-4-methyl-thiazol-2-yl}-azepan-4-ol hydrochloride structure
|
Common Name | 4-{5-[2-(4-Fluoro-phenoxy)-ethyl]-4-methyl-thiazol-2-yl}-azepan-4-ol hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1361111-41-2 | Molecular Weight | 386.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H24ClFN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-{5-[2-(4-Fluoro-phenoxy)-ethyl]-4-methyl-thiazol-2-yl}-azepan-4-ol hydrochloride |
|---|
| Molecular Formula | C18H24ClFN2O2S |
|---|---|
| Molecular Weight | 386.9 |
| InChIKey | DMVOYMOWZHWISA-UHFFFAOYSA-N |
| SMILES | Cc1nc(C2(O)CCCNCC2)sc1CCOc1ccc(F)cc1.Cl |
|
Name: Phenotypic growth assay for Mycobacterium tuberculosis grown for 4 days on DPPC, chol...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4649948
|
|
Name: Mycobacterium tuberculosis Polyketide synthase 13 Thioesterase (PKS13)
Source: ChEMBL
Target: Polyketide synthase Pks13
External Id: CHEMBL4649965
|
|
Name: Phenotypic growth assay for Mycobacterium tuberculosis grown for 3 days on 7H9, gluco...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4649949
|
|
Name: Trypanosoma cruzi histidyl tRNA synthetase (Tc-HisRS)
Source: ChEMBL
Target: histidine--tRNA ligase
External Id: CHEMBL4649954
|
|
Name: Human HepG2 cell viability assay in 384 well format
Source: ChEMBL
Target: N/A
External Id: CHEMBL3507681
|
|
Name: in vitro assay to detect presence of AMC directly proportional to the activity of Clp...
Source: ChEMBL
Target: ATP-dependent Clp protease proteolytic subunit 2
External Id: CHEMBL4649972
|
|
Name: Leishmania donovani Methionine tRNA synthetase (LdMetRS):v6. Primary screen assay
Source: ChEMBL
Target: methionine--tRNA ligase
External Id: CHEMBL3988443
|
|
Name: Biomol Green assay for MtCoaBC inhibitor, OD650 read
Source: ChEMBL
Target: Coenzyme A biosynthesis bifunctional protein CoaBC
External Id: CHEMBL4649941
|
|
Name: Biochemical assay for Mt-TrpRS
Source: ChEMBL
Target: Tryptophan--tRNA ligase
External Id: CHEMBL4649957
|
|
Name: Leishmania infantum Histidine tRNA synthetase (LdHisRS)
Source: ChEMBL
Target: histidine--tRNA ligase
External Id: CHEMBL4649962
|