1',2',3',4',5',6'-Hexahydro-[2,3']bipyridinyl-5-carboxylic acidcyclopentylamide hydrochloride structure
|
Common Name | 1',2',3',4',5',6'-Hexahydro-[2,3']bipyridinyl-5-carboxylic acidcyclopentylamide hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1361111-77-4 | Molecular Weight | 309.83 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1',2',3',4',5',6'-Hexahydro-[2,3']bipyridinyl-5-carboxylic acidcyclopentylamide hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H24ClN3O |
|---|---|
| Molecular Weight | 309.83 |
| InChIKey | NPOYNXCTOAEKTJ-UHFFFAOYSA-N |
| SMILES | Cl.O=C(NC1CCCC1)c1ccc(C2CCCNC2)nc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Phenotypic growth assay for Mycobacterium tuberculosis grown for 4 days on DPPC, chol...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4649948
|
|
Name: Mycobacterium tuberculosis Polyketide synthase 13 Thioesterase (PKS13)
Source: ChEMBL
Target: Polyketide synthase Pks13
External Id: CHEMBL4649965
|
|
Name: Phenotypic growth assay for Mycobacterium tuberculosis grown for 3 days on 7H9, gluco...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4649949
|
|
Name: Trypanosoma cruzi histidyl tRNA synthetase (Tc-HisRS)
Source: ChEMBL
Target: histidine--tRNA ligase
External Id: CHEMBL4649954
|
|
Name: Human HepG2 cell viability assay in 384 well format
Source: ChEMBL
Target: N/A
External Id: CHEMBL3507681
|
|
Name: in vitro assay to detect presence of AMC directly proportional to the activity of Clp...
Source: ChEMBL
Target: ATP-dependent Clp protease proteolytic subunit 2
External Id: CHEMBL4649972
|
|
Name: Leishmania donovani Methionine tRNA synthetase (LdMetRS):v6. Primary screen assay
Source: ChEMBL
Target: methionine--tRNA ligase
External Id: CHEMBL3988443
|
|
Name: Biomol Green assay for MtCoaBC inhibitor, OD650 read
Source: ChEMBL
Target: Coenzyme A biosynthesis bifunctional protein CoaBC
External Id: CHEMBL4649941
|
|
Name: Biochemical assay for Mt-TrpRS
Source: ChEMBL
Target: Tryptophan--tRNA ligase
External Id: CHEMBL4649957
|
|
Name: Leishmania infantum Histidine tRNA synthetase (LdHisRS)
Source: ChEMBL
Target: histidine--tRNA ligase
External Id: CHEMBL4649962
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1',2',3',4',5',6'-Hexahydro-[2,3']bipyridinyl-5-carboxylic acidcyclopentylamide hydrochloride? |
| A: SMILES notation of 1',2',3',4',5',6'-Hexahydro-[2,3']bipyridinyl-5-carboxylic acidcyclopentylamide hydrochloride is Cl.O=C(NC1CCCC1)c1ccc(C2CCCNC2)nc1. |
| Q: What is the English name of 1',2',3',4',5',6'-Hexahydro-[2,3']bipyridinyl-5-carboxylic acidcyclopentylamide hydrochloride? |
| A: The English name of 1',2',3',4',5',6'-Hexahydro-[2,3']bipyridinyl-5-carboxylic acidcyclopentylamide hydrochloride is 1',2',3',4',5',6'-Hexahydro-[2,3']bipyridinyl-5-carboxylic acidcyclopentylamide hydrochloride. |
| Q: What is the molecular formula of 1',2',3',4',5',6'-Hexahydro-[2,3']bipyridinyl-5-carboxylic acidcyclopentylamide hydrochloride? |
| A: Molecular formula of 1',2',3',4',5',6'-Hexahydro-[2,3']bipyridinyl-5-carboxylic acidcyclopentylamide hydrochloride is C16H24ClN3O. |
| Q: What is the CAS number of 1',2',3',4',5',6'-Hexahydro-[2,3']bipyridinyl-5-carboxylic acidcyclopentylamide hydrochloride? |
| A: CAS number of 1',2',3',4',5',6'-Hexahydro-[2,3']bipyridinyl-5-carboxylic acidcyclopentylamide hydrochloride is 1361111-77-4. |
| Q: What is the molecular weight of 1',2',3',4',5',6'-Hexahydro-[2,3']bipyridinyl-5-carboxylic acidcyclopentylamide hydrochloride? |
| A: Molecular weight of 1',2',3',4',5',6'-Hexahydro-[2,3']bipyridinyl-5-carboxylic acidcyclopentylamide hydrochloride is 309.83. |
| Q: What is the Chinese name of 1361111-77-4? |
| A: Chinese name of 1361111-77-4 is 1361111-77-4. |
| Q: What is the InChIKey of 1',2',3',4',5',6'-Hexahydro-[2,3']bipyridinyl-5-carboxylic acidcyclopentylamide hydrochloride? |
| A: InChIKey of 1',2',3',4',5',6'-Hexahydro-[2,3']bipyridinyl-5-carboxylic acidcyclopentylamide hydrochloride is NPOYNXCTOAEKTJ-UHFFFAOYSA-N. |