4-Fluoro-5-(2,3,5-trichlorophenyl)indole
Modify Date: 2025-09-09 19:32:37
4-Fluoro-5-(2,3,5-trichlorophenyl)indole structure
|
Common Name | 4-Fluoro-5-(2,3,5-trichlorophenyl)indole | ||
|---|---|---|---|---|
| CAS Number | 1361538-59-1 | Molecular Weight | 314.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H7Cl3FN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Fluoro-5-(2,3,5-trichlorophenyl)indole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H7Cl3FN |
|---|---|
| Molecular Weight | 314.6 |
| InChIKey | KEBVZVJAOKRNRB-UHFFFAOYSA-N |
| SMILES | Fc1c(-c2cc(Cl)cc(Cl)c2Cl)ccc2[nH]ccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-Fluoro-5-(2,3,5-trichlorophenyl)indole? |
| A: SMILES notation of 4-Fluoro-5-(2,3,5-trichlorophenyl)indole is Fc1c(-c2cc(Cl)cc(Cl)c2Cl)ccc2[nH]ccc12. |
| Q: What is the molecular weight of 4-Fluoro-5-(2,3,5-trichlorophenyl)indole? |
| A: Molecular weight of 4-Fluoro-5-(2,3,5-trichlorophenyl)indole is 314.6. |
| Q: What is the Chinese name of 1361538-59-1? |
| A: Chinese name of 1361538-59-1 is 1361538-59-1. |
| Q: What is the molecular formula of 4-Fluoro-5-(2,3,5-trichlorophenyl)indole? |
| A: Molecular formula of 4-Fluoro-5-(2,3,5-trichlorophenyl)indole is C14H7Cl3FN. |
| Q: What is the InChIKey of 4-Fluoro-5-(2,3,5-trichlorophenyl)indole? |
| A: InChIKey of 4-Fluoro-5-(2,3,5-trichlorophenyl)indole is KEBVZVJAOKRNRB-UHFFFAOYSA-N. |
| Q: What is the English name of 4-Fluoro-5-(2,3,5-trichlorophenyl)indole? |
| A: The English name of 4-Fluoro-5-(2,3,5-trichlorophenyl)indole is 4-Fluoro-5-(2,3,5-trichlorophenyl)indole. |
| Q: What is the CAS number of 4-Fluoro-5-(2,3,5-trichlorophenyl)indole? |
| A: CAS number of 4-Fluoro-5-(2,3,5-trichlorophenyl)indole is 1361538-59-1. |