[2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine
Modify Date: 2026-07-10 11:27:47
![[2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine Structure](https://www.chemsrc.com/extcaspic/203/1361597-83-2.png)
[2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine structure
|
Common Name | [2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine | ||
|---|---|---|---|---|
| CAS Number | 1361597-83-2 | Molecular Weight | 337.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13Cl4N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H13Cl4N |
|---|---|
| Molecular Weight | 337.1 |
| InChIKey | GSIBXLOQPGYFKA-UHFFFAOYSA-N |
| SMILES | CN(C)c1cc(C2CC(Cl)=CC(Cl)=C2Cl)ccc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of [2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine? |
| A: CAS number of [2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine is 1361597-83-2. |
| Q: What is the molecular weight of [2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine? |
| A: Molecular weight of [2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine is 337.1. |
| Q: What is the Chinese name of 1361597-83-2? |
| A: Chinese name of 1361597-83-2 is 1361597-83-2. |
| Q: What is the molecular formula of [2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine? |
| A: Molecular formula of [2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine is C14H13Cl4N. |
| Q: What is the InChIKey of [2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine? |
| A: InChIKey of [2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine is GSIBXLOQPGYFKA-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of [2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine? |
| A: SMILES notation of [2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine is CN(C)c1cc(C2CC(Cl)=CC(Cl)=C2Cl)ccc1Cl. |
| Q: What is the English name of [2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine? |
| A: The English name of [2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine is [2-Chloro-5-(2,3,5-trichlorocyclohexa-2,4-dienyl)-phenyl]-dimethyl-amine. |