1-(ethoxymethyl)-6-phenylsulfanyl-5-propan-2-yl-2-sulfanylidenepyrimidin-4-one
Modify Date: 2025-09-21 20:51:26
1-(ethoxymethyl)-6-phenylsulfanyl-5-propan-2-yl-2-sulfanylidenepyrimidin-4-one structure
|
Common Name | 1-(ethoxymethyl)-6-phenylsulfanyl-5-propan-2-yl-2-sulfanylidenepyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 136160-33-3 | Molecular Weight | 336.47200 | |
| Density | 1.26g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H20N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(ethoxymethyl)-6-phenylsulfanyl-5-propan-2-yl-2-sulfanylidenepyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Molecular Formula | C16H20N2O2S2 |
| Molecular Weight | 336.47200 |
| Exact Mass | 336.09700 |
| PSA | 104.67000 |
| LogP | 4.58680 |
| Index of Refraction | 1.634 |
| InChIKey | JBXJJJIJIRTXCY-UHFFFAOYSA-N |
| SMILES | CCOCn1c(Sc2ccccc2)c(C(C)C)c(=O)[nH]c1=S |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:882-33-7
CAS#:136160-32-2|
Name: Effective concentration required for 50% protection of MT-4 cells against the cytopat...
Source: ChEMBL
Target: Human immunodeficiency virus 1
External Id: CHEMBL712346
|
|
Name: Ratio of the EC50 against HIV-1 infected MT-4 cells and CC50 against mock infected MT...
Source: ChEMBL
Target: MT4
External Id: CHEMBL838556
|
|
Name: Inhibitory concentration against HIV-1 reverse transcriptase
Source: ChEMBL
Target: Reverse transcriptase/RNaseH
External Id: CHEMBL804270
|
|
Name: Concentration required to reduce viability of mock-infected MT-4 cells
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL844556
|
|
Name: Antiviral activity against HIV1 3B infected in human MT4 cells assessed as protection...
Source: ChEMBL
Target: Human immunodeficiency virus 1
External Id: CHEMBL3243451
|
Total 6, Current Page 1 of 1
1
| 1-EtOMe-6PhS-5-i-Pr2thio U |
| I-EPU-S |
| 5-Isopropyl-1-ethoxymethyl-6-(phenylthio)-2-thiouracil |