4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile
Modify Date: 2026-08-05 14:29:08
4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile structure
|
Common Name | 4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile | ||
|---|---|---|---|---|
| CAS Number | 1361602-03-0 | Molecular Weight | 351.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H9Cl3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H9Cl3N2O |
|---|---|
| Molecular Weight | 351.6 |
| InChIKey | ZDFWBPLJMVSUGI-UHFFFAOYSA-N |
| SMILES | N#CCc1c[nH]c2ccc(-c3cc(Cl)cc(Cl)c3Cl)c(O)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile? |
| A: SMILES notation of 4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile is N#CCc1c[nH]c2ccc(-c3cc(Cl)cc(Cl)c3Cl)c(O)c12. |
| Q: What is the molecular formula of 4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile? |
| A: Molecular formula of 4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile is C16H9Cl3N2O. |
| Q: What is the Chinese name of 1361602-03-0? |
| A: Chinese name of 1361602-03-0 is 1361602-03-0. |
| Q: What is the InChIKey of 4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile? |
| A: InChIKey of 4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile is ZDFWBPLJMVSUGI-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile? |
| A: CAS number of 4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile is 1361602-03-0. |
| Q: What is the English name of 4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile? |
| A: The English name of 4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile is 4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile. |
| Q: What is the molecular weight of 4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile? |
| A: Molecular weight of 4-Hydroxy-5-(2,3,5-trichlorophenyl)indole-3-acetonitrile is 351.6. |