2,3-Dichloro-2'-(difluoromethoxy)-6'-fluoro-1,1'-biphenyl structure
|
Common Name | 2,3-Dichloro-2'-(difluoromethoxy)-6'-fluoro-1,1'-biphenyl | ||
|---|---|---|---|---|
| CAS Number | 1361745-28-9 | Molecular Weight | 307.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7Cl2F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Dichloro-2'-(difluoromethoxy)-6'-fluoro-1,1'-biphenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H7Cl2F3O |
|---|---|
| Molecular Weight | 307.09 |
| InChIKey | UASNJGBURMOJQW-UHFFFAOYSA-N |
| SMILES | Fc1cccc(OC(F)F)c1-c1cccc(Cl)c1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,3-Dichloro-2'-(difluoromethoxy)-6'-fluoro-1,1'-biphenyl? |
| A: The English name of 2,3-Dichloro-2'-(difluoromethoxy)-6'-fluoro-1,1'-biphenyl is 2,3-Dichloro-2'-(difluoromethoxy)-6'-fluoro-1,1'-biphenyl. |
| Q: What is the molecular weight of 2,3-Dichloro-2'-(difluoromethoxy)-6'-fluoro-1,1'-biphenyl? |
| A: Molecular weight of 2,3-Dichloro-2'-(difluoromethoxy)-6'-fluoro-1,1'-biphenyl is 307.09. |
| Q: What is the InChIKey of 2,3-Dichloro-2'-(difluoromethoxy)-6'-fluoro-1,1'-biphenyl? |
| A: InChIKey of 2,3-Dichloro-2'-(difluoromethoxy)-6'-fluoro-1,1'-biphenyl is UASNJGBURMOJQW-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,3-Dichloro-2'-(difluoromethoxy)-6'-fluoro-1,1'-biphenyl? |
| A: Molecular formula of 2,3-Dichloro-2'-(difluoromethoxy)-6'-fluoro-1,1'-biphenyl is C13H7Cl2F3O. |
| Q: What is the CAS number of 2,3-Dichloro-2'-(difluoromethoxy)-6'-fluoro-1,1'-biphenyl? |
| A: CAS number of 2,3-Dichloro-2'-(difluoromethoxy)-6'-fluoro-1,1'-biphenyl is 1361745-28-9. |
| Q: What is the SMILES notation of 2,3-Dichloro-2'-(difluoromethoxy)-6'-fluoro-1,1'-biphenyl? |
| A: SMILES notation of 2,3-Dichloro-2'-(difluoromethoxy)-6'-fluoro-1,1'-biphenyl is Fc1cccc(OC(F)F)c1-c1cccc(Cl)c1Cl. |
| Q: What is the Chinese name of 1361745-28-9? |
| A: Chinese name of 1361745-28-9 is 1361745-28-9. |