3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl
Modify Date: 2025-09-09 20:10:42
3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl structure
|
Common Name | 3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl | ||
|---|---|---|---|---|
| CAS Number | 1361764-16-0 | Molecular Weight | 357.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H7Cl2F5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H7Cl2F5O |
|---|---|
| Molecular Weight | 357.1 |
| InChIKey | VBGQGQGLMXDHSR-UHFFFAOYSA-N |
| SMILES | FC(F)Oc1c(-c2cc(Cl)cc(Cl)c2)cccc1C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1361764-16-0? |
| A: Chinese name of 1361764-16-0 is 1361764-16-0. |
| Q: What is the InChIKey of 3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl? |
| A: InChIKey of 3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl is VBGQGQGLMXDHSR-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl? |
| A: SMILES notation of 3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl is FC(F)Oc1c(-c2cc(Cl)cc(Cl)c2)cccc1C(F)(F)F. |
| Q: What is the CAS number of 3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl? |
| A: CAS number of 3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl is 1361764-16-0. |
| Q: What is the molecular weight of 3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl? |
| A: Molecular weight of 3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl is 357.1. |
| Q: What is the English name of 3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl? |
| A: The English name of 3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl is 3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl. |
| Q: What is the molecular formula of 3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl? |
| A: Molecular formula of 3',5'-Dichloro-2-(difluoromethoxy)-3-(trifluoromethyl)-1,1'-biphenyl is C14H7Cl2F5O. |