2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol
Modify Date: 2026-09-27 23:59:23
2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol structure
|
Common Name | 2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol | ||
|---|---|---|---|---|
| CAS Number | 1361908-89-5 | Molecular Weight | 268.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11Cl2NO |
|---|---|
| Molecular Weight | 268.13 |
| InChIKey | ZPSVRCRXSWKZRD-UHFFFAOYSA-N |
| SMILES | Cc1cnc(-c2cc(Cl)ccc2Cl)c(CO)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol? |
| A: CAS number of 2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol is 1361908-89-5. |
| Q: What is the InChIKey of 2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol? |
| A: InChIKey of 2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol is ZPSVRCRXSWKZRD-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol? |
| A: Molecular formula of 2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol is C13H11Cl2NO. |
| Q: What is the Chinese name of 1361908-89-5? |
| A: Chinese name of 1361908-89-5 is 1361908-89-5. |
| Q: What is the SMILES notation of 2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol? |
| A: SMILES notation of 2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol is Cc1cnc(-c2cc(Cl)ccc2Cl)c(CO)c1. |
| Q: What is the molecular weight of 2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol? |
| A: Molecular weight of 2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol is 268.13. |
| Q: What is the English name of 2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol? |
| A: The English name of 2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol is 2-(2,5-Dichlorophenyl)-5-methylpyridine-3-methanol. |