Sodium 2-amino-4,4'-dichlorodiphenylether-2'-sulfonate structure
|
Common Name | Sodium 2-amino-4,4'-dichlorodiphenylether-2'-sulfonate | ||
|---|---|---|---|---|
| CAS Number | 136213-81-5 | Molecular Weight | 356.15700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8Cl2NNaO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,2-(2-amino-4-chlorophenoxy)-5-chlorobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8Cl2NNaO4S |
|---|---|
| Molecular Weight | 356.15700 |
| Exact Mass | 354.94500 |
| PSA | 100.83000 |
| LogP | 4.93400 |
| InChIKey | YONKDBGAJAYCGT-UHFFFAOYSA-M |
| SMILES | Nc1cc(Cl)ccc1Oc1ccc(Cl)cc1S(=O)(=O)[O-].[Na+] |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-AMINO-4,4'-DICHLORODIPHENYLETHER-2'-SULFONATE,SODIUMSALT |
| Sodium 2-amino-4,4'-dichlorodiphenylether-2'-sulfonate |
| sodium 2-(2-amino-4-chlorophenoxy)-5-chlorobenzenesulfonate |
| I14-7762 |