(1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene
![(1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene Structure](https://image.chemsrc.com/caspic/383/136296-35-0.png)
(1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene structure
|
Common Name | (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene | ||
|---|---|---|---|---|
| CAS Number | 136296-35-0 | Molecular Weight | 204.35100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene, CAS number 136296-35-0, molecular formula C15H24, molecular weight 204.35100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H24 |
|---|---|
| Molecular Weight | 204.35100 |
| Exact Mass | 204.18800 |
| LogP | 4.72520 |
| InChIKey | NSMRKFBAPAOVQL-RDNHTORASA-N |
| SMILES | C=C1CCCC(C)=CCC2C1CC2(C)C |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undec-3-ene |
| (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undec-3-ene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene? |
| A: Molecular weight of (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene is 204.35100. |
| Q: What is the Chinese name of 136296-35-0? |
| A: Chinese name of 136296-35-0 is 136296-35-0. |
| Q: What English synonyms does (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene have? |
| A: English synonyms of (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene: (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undec-3-ene, (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undec-3-ene. |
| Q: What is the LogP of (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene? |
| A: LogP of (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene is 4.72520. |
| Q: What is the English name of (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene? |
| A: The English name of (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene is (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene. |
| Q: What is the InChIKey of (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene? |
| A: InChIKey of (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene is NSMRKFBAPAOVQL-RDNHTORASA-N. |
| Q: What is the molecular formula of (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene? |
| A: Molecular formula of (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene is C15H24. |
| Q: What is the SMILES notation of (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene? |
| A: SMILES notation of (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene is C=C1CCCC(C)=CCC2C1CC2(C)C. |
| Q: What is the CAS number of (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene? |
| A: CAS number of (1R,3Z,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undeca-3-ene is 136296-35-0. |