[3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]methanol structure
|
Common Name | [3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]methanol | ||
|---|---|---|---|---|
| CAS Number | 136316-22-8 | Molecular Weight | 342.50400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H26O3Si |
|---|---|
| Molecular Weight | 342.50400 |
| Exact Mass | 342.16500 |
| PSA | 41.99000 |
| LogP | 2.32270 |
| InChIKey | AMSACQIRJIGRBF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](OCC1OC1CO)(c1ccccc1)c1ccccc1 |
|
~99%
[3-[[tert-butyl... CAS#:136316-22-8 |
| Literature: Bradshaw, Ben; Collison, David; Garner, C. David; Joule, John A. Organic and Biomolecular Chemistry, 2003 , vol. 1, # 1 p. 129 - 133 |
|
~%
[3-[[tert-butyl... CAS#:136316-22-8 |
| Literature: Bradshaw, Ben; Collison, David; Garner, C. David; Joule, John A. Organic and Biomolecular Chemistry, 2003 , vol. 1, # 1 p. 129 - 133 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-hydroxymethyl-2-tert-butyldiphenylsiloxymethyloxirane |
| Oxiranemethanol,3-[[[(1,1-dimethylethyl)diphenylsilyl]oxy]methyl] |