5-acetamido-2-methylbenzenesulfonyl chloride structure
|
Common Name | 5-acetamido-2-methylbenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 13632-07-0 | Molecular Weight | 247.69900 | |
| Density | 1.411g/cm3 | Boiling Point | 435.4ºC at 760mmHg | |
| Molecular Formula | C9H10ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.1ºC | |
| Name | 5-acetamido-2-methylbenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.411g/cm3 |
|---|---|
| Boiling Point | 435.4ºC at 760mmHg |
| Molecular Formula | C9H10ClNO3S |
| Molecular Weight | 247.69900 |
| Flash Point | 217.1ºC |
| Exact Mass | 247.00700 |
| PSA | 71.62000 |
| LogP | 3.03470 |
| Vapour Pressure | 8.79E-08mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | BCGUUSFEJVCVLK-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C)c(S(=O)(=O)Cl)c1 |
| HS Code | 2924299090 |
|---|
|
~77%
5-acetamido-2-m... CAS#:13632-07-0 |
| Literature: Kendall, Jackie D.; Giddens, Anna C.; Tsang, Kit Yee; Frederick, Raphael; Marshall, Elaine S.; Singh, Ripudaman; Lill, Claire L.; Lee, Woo-Jeong; Kolekar, Sharada; Chao, Mindy; Malik, Alisha; Yu, Shuqiao; Chaussade, Claire; Buchanan, Christina; Rewcastle, Gordon W.; Baguley, Bruce C.; Flanagan, Jack U.; Jamieson, Stephen M.F.; Denny, William A.; Shepherd, Peter R. Bioorganic and Medicinal Chemistry, 2012 , vol. 20, # 1 p. 58 - 68 |
|
~%
5-acetamido-2-m... CAS#:13632-07-0 |
| Literature: Johnson; Smiles Journal of the Chemical Society, 1923 , vol. 123, p. 2386 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Acetamino-toluol-sulfonylchlorid-(2) |
| 4-acetylamino-toluene-2-sulfonyl chloride |
| 5-Acetamido-2-methylbenzenesulphonyl chloride |
| 4-Acetylamino-toluol-2-sulfonylchlorid |
| 4-Acetamino-toluol-sulfonsaeure-(2)-chlorid |
| 5-Acetylamino-2-methylbenzenesulfonyl chloride |