(4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethoxy-4a-methyl-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-one structure
|
Common Name | (4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethoxy-4a-methyl-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-one | ||
|---|---|---|---|---|
| CAS Number | 136379-64-1 | Molecular Weight | 356.57200 | |
| Density | 0.99g/cm3 | Boiling Point | 383.1ºC at 760 mmHg | |
| Molecular Formula | C19H36O4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.1ºC | |
| Name | (4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethoxy-4a-methyl-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 383.1ºC at 760 mmHg |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.57200 |
| Flash Point | 154.1ºC |
| Exact Mass | 356.23800 |
| PSA | 44.76000 |
| LogP | 4.53520 |
| Vapour Pressure | 4.5E-06mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | IIQJRZFDGHTZOK-HFTRVMKXSA-N |
| SMILES | COC1(OC)CCC2(C)C(O[Si](C)(C)C(C)(C)C)CCC(=O)C2C1 |
|
~84%
(4S,4aS,8aS)-4-... CAS#:136379-64-1 |
| Literature: Journal of Organic Chemistry, , vol. 56, # 23 p. 6585 - 6591 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (4S,4aS,8aS)-4-(tert-Butyl-dimethylsilyl)oxy-7,7-dimethoxy-4a-methyl-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-one |
| (4S,4aS,8aS)-4-(dimethyl-tert-butyl-silyl)oxy-7,7-dimethoxy-4a-methyl-decalin-1-one |