5-[(2,4-dichlorophenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione structure
|
Common Name | 5-[(2,4-dichlorophenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione | ||
|---|---|---|---|---|
| CAS Number | 136384-19-5 | Molecular Weight | 309.25800 | |
| Density | 1.66g/cm3 | Boiling Point | 417.8ºC at 760 mmHg | |
| Molecular Formula | C9H6Cl2N2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.5ºC | |
| Name | 5-[(2,4-dichlorophenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66g/cm3 |
|---|---|
| Boiling Point | 417.8ºC at 760 mmHg |
| Molecular Formula | C9H6Cl2N2S3 |
| Molecular Weight | 309.25800 |
| Flash Point | 206.5ºC |
| Exact Mass | 307.90700 |
| PSA | 118.12000 |
| LogP | 4.42590 |
| Vapour Pressure | 3.45E-07mmHg at 25°C |
| Index of Refraction | 1.767 |
| InChIKey | XPKHYWRIWANKDK-UHFFFAOYSA-N |
| SMILES | S=c1[nH]nc(SCc2ccc(Cl)cc2Cl)s1 |
|
~90%
5-[(2,4-dichlor... CAS#:136384-19-5 |
| Literature: Katritzky, Alan R.; Borowiecka, J.; Fan, Wei-Qiang; Brannigan, Lawrence H. Journal of Heterocyclic Chemistry, 1991 , vol. 28, # 4 p. 1139 - 1141 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-[(2,4-dichlorophenyl)methylthio]-3H-1,3,4-thiadiazole-2-thione |
| 5-(2,4-Dichlorobenzylthio)-2-mercapto-1,3,4 |
| 2-(2,4-dichlorobenzylthio)-1,3,4-thiadiazole-5(4H)-thione |
| 5-(2,4-Dichlorobenzylthio)-2-mercapto-1,3,4-thiadiazole |