1-benzoyl-5-pentan-2-yloxypyrrolidin-2-one structure
|
Common Name | 1-benzoyl-5-pentan-2-yloxypyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 136410-19-0 | Molecular Weight | 275.34300 | |
| Density | 1.13g/cm3 | Boiling Point | 411.2ºC at 760 mmHg | |
| Molecular Formula | C16H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.5ºC | |
| Name | 1-benzoyl-5-pentan-2-yloxypyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 411.2ºC at 760 mmHg |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.34300 |
| Flash Point | 202.5ºC |
| Exact Mass | 275.15200 |
| PSA | 46.61000 |
| LogP | 2.91840 |
| Vapour Pressure | 5.68E-07mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | DMNANXGXENPULZ-UHFFFAOYSA-N |
| SMILES | CCCC(C)OC1CCC(=O)N1C(=O)c1ccccc1 |
|
~%
1-benzoyl-5-pen... CAS#:136410-19-0 |
| Literature: Roussel Uclaf Patent: US4948804 A1, 1990 ; |
|
~%
1-benzoyl-5-pen... CAS#:136410-19-0 |
| Literature: Toja, E; Gorini, C; Zirotti, C; Barzaghi, F; Galliani, G European Journal of Medicinal Chemistry, 1991 , vol. 26, # 4 p. 415 - 422 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-benzoyl 5-(2-pentyloxy)-pyrrolidin-2-one |
| 2-Pyrrolidinone,1-benzoyl-2-(1-methylbutoxy)-,(+-) |
| (+-)-1-Benzoyl-2-(1-methylbutoxy)-2-pyrrolidinone |