Methyl 1-(4-bromophenyl)-3-oxocyclobutane-1-carboxylate structure
|
Common Name | Methyl 1-(4-bromophenyl)-3-oxocyclobutane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1364663-42-2 | Molecular Weight | 283.11800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 1-(4-bromophenyl)-3-oxocyclobutanecarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11BrO3 |
|---|---|
| Molecular Weight | 283.11800 |
| Exact Mass | 281.98900 |
| PSA | 43.37000 |
| LogP | 2.22280 |
| InChIKey | LURHGJIPPTYEDO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(c2ccc(Br)cc2)CC(=O)C1 |
| Storage condition | 2-8°C |
| HS Code | 2918300090 |
|---|
|
~%
Methyl 1-(4-bro... CAS#:1364663-42-2 |
| Literature: TAIHO PHARMACEUTICAL CO., LTD.; Nakamura, Masayuki; Niiyama, Kenji; Kamijo, Kaori; Ohkubo, Mitsuru; Shimomura, Toshiyasu Patent: US2014/5185 A1, 2014 ; |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD22199278 |