1-nitro-3-(3,3,3-trifluoroprop-1-en-2-yl)benzene structure
|
Common Name | 1-nitro-3-(3,3,3-trifluoroprop-1-en-2-yl)benzene | ||
|---|---|---|---|---|
| CAS Number | 136476-19-2 | Molecular Weight | 217.14500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-3-(3,3,3-trifluoroprop-1-en-2-yl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H6F3NO2 |
|---|---|
| Molecular Weight | 217.14500 |
| Exact Mass | 217.03500 |
| PSA | 45.82000 |
| LogP | 3.69350 |
| InChIKey | BOXWWFCXCCQRFT-UHFFFAOYSA-N |
| SMILES | C=C(c1cccc([N+](=O)[O-])c1)C(F)(F)F |
|
~%
1-nitro-3-(3,3,... CAS#:136476-19-2 |
| Literature: Jiang, Biao; Xu, Yuanyao Journal of Organic Chemistry, 1991 , vol. 56, # 26 p. 7336 - 7340 |
|
~%
1-nitro-3-(3,3,... CAS#:136476-19-2 |
| Literature: Jiang, Biao; Xu, Yuanyao Journal of Organic Chemistry, 1991 , vol. 56, # 26 p. 7336 - 7340 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzene,1-nitro-3-[1-(trifluoromethyl)ethenyl] |