3-Aminobenzenesulfonic acid phenyl ester structure
|
Common Name | 3-Aminobenzenesulfonic acid phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 13653-18-4 | Molecular Weight | 249.28600 | |
| Density | 1.344g/cm3 | Boiling Point | 454.4ºC at 760 mmHg | |
| Molecular Formula | C12H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.6ºC | |
| Name | phenyl 3-aminobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.344g/cm3 |
|---|---|
| Boiling Point | 454.4ºC at 760 mmHg |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.28600 |
| Flash Point | 228.6ºC |
| Exact Mass | 249.04600 |
| PSA | 77.77000 |
| LogP | 3.69850 |
| Vapour Pressure | 1.91E-08mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | CHJVFEINHNDFKC-UHFFFAOYSA-N |
| SMILES | Nc1cccc(S(=O)(=O)Oc2ccccc2)c1 |
| HS Code | 2921420090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-Aminobenzenesulfonic acid phenyl ester |
| Phenyl-anilin-m-sulphonat |
| 1-aminobenzene-3-sulphonic acid phenyl ester |
| Benzenesulfonic acid,3-amino-,phenyl ester |
| 3'-amino-benzenesulphonic acid phenyl ester |