Decabromobiphenyl structure
|
Common Name | Decabromobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 13654-09-6 | Molecular Weight | 943.168 | |
| Density | 3.0±0.1 g/cm3 | Boiling Point | 568.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C12Br10 | Melting Point | 380-386ºC | |
| MSDS | N/A | Flash Point | 285.3±23.5 °C | |
Use of DecabromobiphenylDecabromobiphenyl is a flame retardant and a standard for environmental testing and research. |
| Name | Decabromobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 3.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 568.3±45.0 °C at 760 mmHg |
| Melting Point | 380-386ºC |
| Molecular Formula | C12Br10 |
| Molecular Weight | 943.168 |
| Flash Point | 285.3±23.5 °C |
| Exact Mass | 933.183289 |
| LogP | 9.44 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.741 |
| InChIKey | AQPHBYQUCKHJLT-UHFFFAOYSA-N |
| SMILES | Brc1c(Br)c(Br)c(-c2c(Br)c(Br)c(Br)c(Br)c2Br)c(Br)c1Br |
| RIDADR | UN 3152 |
|---|---|
| Packaging Group | II |
| Hazard Class | 9 |
| HS Code | 2903999010 |
|
~%
Decabromobiphenyl CAS#:13654-09-6 |
| Literature: Chemosphere, , vol. 71, # 2 p. 352 - 359 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903999010 |
|---|---|
| Summary | 2903999010 2,3,3',4,5,6-hexachloro-1,1'-biphenyl。supervision conditions:89(articles on the list of prohibited export goods,articles on the list of prohibited import goods)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:5.5%。general tariff:30.0% |
| 1,1'-Biphenyl, 2,2',3,3',4,4',5,5',6,6'-decabromo- |
| 1,2,3,4,5-pentabromo-6-(2,3,4,5,6-pentabromophenyl)benzene |
| Decabromobiphenyl |