3-[4-[4-(2-carboxyethyl)phenoxy]phenyl]propanoic Acid structure
|
Common Name | 3-[4-[4-(2-carboxyethyl)phenoxy]phenyl]propanoic Acid | ||
|---|---|---|---|---|
| CAS Number | 13655-10-2 | Molecular Weight | 314.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[4-[4-(2-carboxyethyl)phenoxy]phenyl]propanoic Acid |
|---|
| Molecular Formula | C18H18O5 |
|---|---|
| Molecular Weight | 314.3 |
| InChIKey | UKCHMOVWJBXLBX-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ccc(Oc2ccc(CCC(=O)O)cc2)cc1 |
|
Name: Phytotoxicity against Lactuca sativa (lettuce) assessed as reduction of shoot elongat...
Source: ChEMBL
Target: Lactuca sativa
External Id: CHEMBL3059594
|
|
Name: Phytotoxicity against Lactuca sativa (lettuce) assessed as reduction of root elongati...
Source: ChEMBL
Target: Lactuca sativa
External Id: CHEMBL3059595
|
|
Name: Phytotoxicity against Lactuca sativa (lettuce) assessed as reduction of seed germinat...
Source: ChEMBL
Target: Lactuca sativa
External Id: CHEMBL3059596
|
|
Name: Phytotoxicity against Lactuca sativa (lettuce) assessed as reduction of seed germinat...
Source: ChEMBL
Target: Lactuca sativa
External Id: CHEMBL3060068
|