3-[(Biphenyl-3-ylsulfonyl)amino]benzoic acid
Modify Date: 2025-11-06 20:05:35
![3-[(Biphenyl-3-ylsulfonyl)amino]benzoic acid Structure](https://www.chemsrc.com/extcaspic/228/1365720-26-8.png)
3-[(Biphenyl-3-ylsulfonyl)amino]benzoic acid structure
|
Common Name | 3-[(Biphenyl-3-ylsulfonyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1365720-26-8 | Molecular Weight | 353.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[(Biphenyl-3-ylsulfonyl)amino]benzoic acid |
|---|
| Molecular Formula | C19H15NO4S |
|---|---|
| Molecular Weight | 353.4 |
| InChIKey | VMDAPLBIOHQKQX-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(NS(=O)(=O)c2cccc(-c3ccccc3)c2)c1 |
|
Name: Kinase Assay (Method B) from US Patent US9233946: "Sulfonamide compounds"
Source: BindingDB
Target: N/A
External Id: BindingDB_7548_2
|
|
Name: Inhibition of PFKFB3 (unknown origin) by ADP-Glo luminescent assay
Source: ChEMBL
Target: 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3
External Id: CHEMBL5230585
|
|
Name: Inhibition of PFKFB3 (unknown origin) expressed in Escherichia coli assessed as ADP l...
Source: ChEMBL
Target: 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3
External Id: CHEMBL3734143
|
Total 3, Current Page 1 of 1
1