1-chloro-3-phenoxysulfonyl-benzene structure
|
Common Name | 1-chloro-3-phenoxysulfonyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 13659-18-2 | Molecular Weight | 268.71600 | |
| Density | 1.377g/cm3 | Boiling Point | 411.4ºC at 760mmHg | |
| Molecular Formula | C12H9ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.6ºC | |
| Name | phenyl 3-chlorobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.377g/cm3 |
|---|---|
| Boiling Point | 411.4ºC at 760mmHg |
| Molecular Formula | C12H9ClO3S |
| Molecular Weight | 268.71600 |
| Flash Point | 202.6ºC |
| Exact Mass | 267.99600 |
| PSA | 51.75000 |
| LogP | 4.18850 |
| Vapour Pressure | 1.34E-06mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | GVCQCUCEMLXYFA-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Oc1ccccc1)c1cccc(Cl)c1 |
| HS Code | 2906299090 |
|---|
|
~%
1-chloro-3-phen... CAS#:13659-18-2 |
| Literature: Tarkka, Richard M.; Park, William K. C.; Liu, Ping; Buncel, Erwin; Hoz, Shmaryahu Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1994 , # 12 p. 2439 - 2444 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1-CHLORO-3-PHENOXYSULFONYL-BENZENE |
| Benzenesulfonic acid,m-chloro-phenyl ester |
| Benzenesulfonic acid,3-chlorophenyl ester |