PSMA-11 structure
|
Common Name | PSMA-11 | ||
|---|---|---|---|---|
| CAS Number | 1366302-52-4 | Molecular Weight | 946.993 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1275.1±65.0 °C at 760 mmHg | |
| Molecular Formula | C44H62N6O17 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 725.0±34.3 °C | |
Use of PSMA-11PSMA-11 is a positron emission tomography (PET) tracer. PSMA-11 detects prostate cancer relapses and metastases by binding to the extracellular domain of prostate-specific membrane antigen (PSMA)[1]. |
| Name | 9AG41L3AOQ |
|---|---|
| Synonym | More Synonyms |
| Description | PSMA-11 is a positron emission tomography (PET) tracer. PSMA-11 detects prostate cancer relapses and metastases by binding to the extracellular domain of prostate-specific membrane antigen (PSMA)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1275.1±65.0 °C at 760 mmHg |
| Molecular Formula | C44H62N6O17 |
| Molecular Weight | 946.993 |
| Flash Point | 725.0±34.3 °C |
| Exact Mass | 946.417175 |
| LogP | 0.20 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | QJUIUFGOTBRHKP-LQJZCPKCSA-N |
| SMILES | O=C(O)CCc1ccc(O)c(CN(CCN(CC(=O)O)Cc2cc(CCC(=O)NCCCCCC(=O)NCCCCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O)ccc2O)CC(=O)O)c1 |
| N-({(1S)-1-Carboxy-5-[(6-{[3-(3-{[(2-{[5-(2-carboxyethyl)-2-hydroxybenzyl](carboxymethyl)amino}ethyl)(carboxymethyl)amino]methyl}-4-hydroxyphenyl)propanoyl]amino}hexanoyl)amino]pentyl}carbamoyl)-L-glutamic acid |
| L-Glutamic acid, N-[[[(1S)-1-carboxy-5-[[6-[[3-[3-[[[2-[[[5-(2-carboxyethyl)-2-hydroxyphenyl]methyl](carboxymethyl)amino]ethyl](carboxymethyl)amino]methyl]-4-hydroxyphenyl]-1-oxopropyl]amino]-1-oxohexyl]amino]pentyl]amino]carbonyl]- |
| 9AG41L3AOQ |
| PSMA-HBED-CC |