4-Chloro-6-methoxy quinoline-3-carbonitrile
4-Chloro-6-methoxy quinoline-3-carbonitrile structure
|
Common Name | 4-Chloro-6-methoxy quinoline-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 13669-62-0 | Molecular Weight | 218.63900 | |
| Density | 1.36g/cm3 | Boiling Point | 385.3ºC at 760mmHg | |
| Molecular Formula | C11H7ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.8ºC | |
| Name | 4-chloro-6-methoxyquinoline-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 385.3ºC at 760mmHg |
| Molecular Formula | C11H7ClN2O |
| Molecular Weight | 218.63900 |
| Flash Point | 186.8ºC |
| Exact Mass | 218.02500 |
| PSA | 45.91000 |
| LogP | 2.76848 |
| Vapour Pressure | 3.84E-06mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | VIKNILFXAQPQEF-UHFFFAOYSA-N |
| SMILES | COc1ccc2ncc(C#N)c(Cl)c2c1 |
| HS Code | 2933499090 |
|---|
|
~63%
4-Chloro-6-meth... CAS#:13669-62-0 |
| Literature: GLAXO GROUP LIMITED Patent: WO2006/2047 A2, 2006 ; Location in patent: Page/Page column 61 ; |
|
~%
4-Chloro-6-meth... CAS#:13669-62-0 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 10, # 24 p. 2825 - 2828 |
|
~%
4-Chloro-6-meth... CAS#:13669-62-0 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 10, # 24 p. 2825 - 2828 |
|
~%
4-Chloro-6-meth... CAS#:13669-62-0 |
| Literature: WO2014/57415 A2, ; |
|
~%
4-Chloro-6-meth... CAS#:13669-62-0 |
| Literature: WO2014/57415 A2, ; |
|
~%
4-Chloro-6-meth... CAS#:13669-62-0 |
| Literature: WO2014/57415 A2, ; |
|
~%
4-Chloro-6-meth... CAS#:13669-62-0 |
| Literature: WO2014/57415 A2, ; |
|
~%
4-Chloro-6-meth... CAS#:13669-62-0 |
| Literature: WO2014/57415 A2, ; |
|
~%
4-Chloro-6-meth... CAS#:13669-62-0 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 10, # 24 p. 2825 - 2828 |
![methyl 2-{[(1E)-(dimethylamino)methylidene]amino}-5-(methyloxy)benzoate structure](https://image.chemsrc.com/caspic/092/872714-53-9.png)
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Quinolinecarbonitrile,4-chloro-6-methoxy |
| 3-Cyan-4-chlor-6-methoxy-chinolin |
| 3-Cyan-4-cyan-6-methoxy-chinolin |
| 4-chloro-6-methoxy-quinoline-3-carbonitrile |
| 4-chloro-6-(methyloxy)-3-quinolinecarbonitrile |
| 4-chloro-6-methoxy-3-quinolinecarbonitrile |