[2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate
Modify Date: 2025-09-28 11:51:48
![[2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate Structure](https://image.chemsrc.com/caspic/039/136708-89-9.png)
[2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate structure
|
Common Name | [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate | ||
|---|---|---|---|---|
| CAS Number | 136708-89-9 | Molecular Weight | 319.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8F3NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8F3NO2S2 |
|---|---|
| Molecular Weight | 319.32300 |
| Exact Mass | 318.99500 |
| PSA | 91.56000 |
| LogP | 3.74870 |
| InChIKey | GOXRPDOFGWBSAY-UHFFFAOYSA-N |
| SMILES | CC(=O)OCc1csc(=S)n1-c1ccc(F)c(F)c1F |
|
~%
[2-sulfanyliden... CAS#:136708-89-9 |
| Literature: Taguchi; Kondo; Inoue; Kawahata; Jinbo; Sakamoto; Tsukamoto Journal of Medicinal Chemistry, 1992 , vol. 35, # 1 p. 94 - 99 |
|
~%
[2-sulfanyliden... CAS#:136708-89-9 |
| Literature: Taguchi; Kondo; Inoue; Kawahata; Jinbo; Sakamoto; Tsukamoto Journal of Medicinal Chemistry, 1992 , vol. 35, # 1 p. 94 - 99 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(acetoxymethyl)-3-(2,3,4-trifluorophenyl)-2(3H)-thiazolethione |
| 2(3H)-Thiazolethione,4-[(acetyloxy)methyl]-3-(2,3,4-trifluorophenyl) |