[2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate
![[2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate Structure](https://image.chemsrc.com/caspic/039/136708-89-9.png)
[2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate structure
|
Common Name | [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate | ||
|---|---|---|---|---|
| CAS Number | 136708-89-9 | Molecular Weight | 319.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8F3NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H8F3NO2S2 |
|---|---|
| Molecular Weight | 319.32300 |
| Exact Mass | 318.99500 |
| PSA | 91.56000 |
| LogP | 3.74870 |
| InChIKey | GOXRPDOFGWBSAY-UHFFFAOYSA-N |
| SMILES | CC(=O)OCc1csc(=S)n1-c1ccc(F)c(F)c1F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[2-sulfanyliden... CAS#:136708-89-9 |
| Literature: Taguchi; Kondo; Inoue; Kawahata; Jinbo; Sakamoto; Tsukamoto Journal of Medicinal Chemistry, 1992 , vol. 35, # 1 p. 94 - 99 |
|
~%
[2-sulfanyliden... CAS#:136708-89-9 |
| Literature: Taguchi; Kondo; Inoue; Kawahata; Jinbo; Sakamoto; Tsukamoto Journal of Medicinal Chemistry, 1992 , vol. 35, # 1 p. 94 - 99 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-(acetoxymethyl)-3-(2,3,4-trifluorophenyl)-2(3H)-thiazolethione |
| 2(3H)-Thiazolethione,4-[(acetyloxy)methyl]-3-(2,3,4-trifluorophenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate? |
| A: Molecular formula of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate is C12H8F3NO2S2. |
| Q: What is the molecular weight of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate? |
| A: Molecular weight of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate is 319.32300. |
| Q: What is the LogP of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate? |
| A: LogP of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate is 3.74870. |
| Q: What is the CAS number of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate? |
| A: CAS number of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate is 136708-89-9. |
| Q: What English synonyms does [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate have? |
| A: English synonyms of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate: 4-(acetoxymethyl)-3-(2,3,4-trifluorophenyl)-2(3H)-thiazolethione, 2(3H)-Thiazolethione,4-[(acetyloxy)methyl]-3-(2,3,4-trifluorophenyl). |
| Q: What is the polar surface area (PSA) of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate? |
| A: Polar surface area (PSA) of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate is 91.56000. |
| Q: What is the Chinese name of 136708-89-9? |
| A: Chinese name of 136708-89-9 is 136708-89-9. |
| Q: What is the SMILES notation of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate? |
| A: SMILES notation of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate is CC(=O)OCc1csc(=S)n1-c1ccc(F)c(F)c1F. |
| Q: What is the English name of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate? |
| A: The English name of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate is [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate. |
| Q: What is the InChIKey of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate? |
| A: InChIKey of [2-sulfanylidene-3-(2,3,4-trifluorophenyl)-1,3-thiazol-4-yl]methyl acetate is GOXRPDOFGWBSAY-UHFFFAOYSA-N. |