2-bromo-N-(2-tritylsulfanylethyl)acetamide structure
|
Common Name | 2-bromo-N-(2-tritylsulfanylethyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 136721-64-7 | Molecular Weight | 440.39600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H22BrNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-N-(2-tritylsulfanylethyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H22BrNOS |
|---|---|
| Molecular Weight | 440.39600 |
| Exact Mass | 439.06100 |
| PSA | 57.89000 |
| LogP | 6.06310 |
| InChIKey | DYLAXLLCKLPULN-UHFFFAOYSA-N |
| SMILES | O=C(CBr)NCCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
|
~88%
2-bromo-N-(2-tr... CAS#:136721-64-7 |
| Literature: Chen, Xiangji; Li, Liang; Liu, Fei; Liu, Boli Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 21 p. 5503 - 5506 |
|
~87%
2-bromo-N-(2-tr... CAS#:136721-64-7 |
| Literature: Mathrubootham, Vaidyanathan; Thomas, Jason; Staples, Richard; McCraken, John; Shearer, Jason; Hegg, Eric L. Inorganic Chemistry, 2010 , vol. 49, # 12 p. 5393 - 5406 |
|
~%
2-bromo-N-(2-tr... CAS#:136721-64-7 |
| Literature: Chen, Xiangji; Li, Liang; Liu, Fei; Liu, Boli Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 21 p. 5503 - 5506 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| N-(2-bromoacetyl)-S-(triphenylmethyl)-2-aminoethanethiol |
| Acetamide,2-bromo-N-[2-[(triphenylmethyl)thio]ethyl] |
| S-trityl-N-bromoacetyl-mercaptoethylamine |
| N-(2-bromoacetyl)-S-triphenylmethyl-cysteamine |