2-cyano-6-nitroquinoline
2-cyano-6-nitroquinoline structure
|
Common Name | 2-cyano-6-nitroquinoline | ||
|---|---|---|---|---|
| CAS Number | 13675-93-9 | Molecular Weight | 199.16600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H5N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-Cyano-6-nitroquinoline (CAS number: 13675-93-9), molecular formula C10H5N3O2, molecular weight 199.16600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-cyano-6-nitroquinoline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H5N3O2 |
|---|---|
| Molecular Weight | 199.16600 |
| Exact Mass | 199.03800 |
| PSA | 82.50000 |
| LogP | 2.53788 |
| InChIKey | PTYMFNBJEHUFCG-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc2cc([N+](=O)[O-])ccc2n1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:627531-51-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Cyano-6-nitrochinolin |
| SC-Q02-0046 6-NITROQUINOLINE-2-CARBONITRILE |
| 6-nitro-quinoline-2-carbonitrile |
| 2-Cyano-6-nitroquinoline |
| 2-Cyano-6-nitro-chinolin |
| 6-Nitro-2-cyan-chinolin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-cyano-6-nitroquinoline? |
| A: Polar surface area (PSA) of 2-cyano-6-nitroquinoline is 82.50000. |
| Q: What is the SMILES notation of 2-cyano-6-nitroquinoline? |
| A: SMILES notation of 2-cyano-6-nitroquinoline is N#Cc1ccc2cc([N+](=O)[O-])ccc2n1. |
| Q: What is the molecular weight of 2-cyano-6-nitroquinoline? |
| A: Molecular weight of 2-cyano-6-nitroquinoline is 199.16600. |
| Q: What is the LogP of 2-cyano-6-nitroquinoline? |
| A: LogP of 2-cyano-6-nitroquinoline is 2.53788. |
| Q: What are the downstream products of 2-cyano-6-nitroquinoline? |
| A: Related downstream products(CAS) of 2-cyano-6-nitroquinoline: 627531-51-5. |
| Q: What is the InChIKey of 2-cyano-6-nitroquinoline? |
| A: InChIKey of 2-cyano-6-nitroquinoline is PTYMFNBJEHUFCG-UHFFFAOYSA-N. |
| Q: What English synonyms does 2-cyano-6-nitroquinoline have? |
| A: English synonyms of 2-cyano-6-nitroquinoline: 2-Cyano-6-nitrochinolin, SC-Q02-0046 6-NITROQUINOLINE-2-CARBONITRILE, 6-nitro-quinoline-2-carbonitrile, 2-Cyano-6-nitroquinoline, 2-Cyano-6-nitro-chinolin, 6-Nitro-2-cyan-chinolin. |
| Q: What is the Chinese name of 13675-93-9? |
| A: Chinese name of 13675-93-9 is 13675-93-9. |
| Q: What is the molecular formula of 2-cyano-6-nitroquinoline? |
| A: Molecular formula of 2-cyano-6-nitroquinoline is C10H5N3O2. |
| Q: What is the English name of 2-cyano-6-nitroquinoline? |
| A: The English name of 2-cyano-6-nitroquinoline is 2-cyano-6-nitroquinoline. |