4,4'-(2,2-Propanediyl)bis[2,6-bis(2-methyl-2-propanyl)phenol] structure
|
Common Name | 4,4'-(2,2-Propanediyl)bis[2,6-bis(2-methyl-2-propanyl)phenol] | ||
|---|---|---|---|---|
| CAS Number | 13676-82-9 | Molecular Weight | 452.71200 | |
| Density | 0.97g/cm3 | Boiling Point | 456ºC at 760mmHg | |
| Molecular Formula | C31H48O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.5ºC | |
| Name | 4,4'-(2,2-Propanediyl)bis[2,6-bis(2-methyl-2-propanyl)phenol] |
|---|---|
| Synonym | More Synonyms |
| Density | 0.97g/cm3 |
|---|---|
| Boiling Point | 456ºC at 760mmHg |
| Molecular Formula | C31H48O2 |
| Molecular Weight | 452.71200 |
| Flash Point | 169.5ºC |
| Exact Mass | 452.36500 |
| PSA | 40.46000 |
| LogP | 8.61370 |
| Vapour Pressure | 6.18E-09mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | QHPKIUDQDCWRKO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(C)(C)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| HS Code | 2907299090 |
|---|
|
~%
4,4'-(2,2-Propa... CAS#:13676-82-9 |
| Literature: Rieker,A. et al. Z. Naturforsch., B: Anorg. Chem., Org. Chem., Biochem., Biophys.,, 1964 , vol. 19, p. 558 - 560 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 1,1'-Biphenyl,2,2'-bis(methoxymethoxy) |
| 2,2'-Bis-(methoxymethoxy)bibenzene |
| 2,2-bis(3,5-di-t-butyl-4-hydroxyphenyl)propane |
| 4,4'-isopropylidenebis(2,6-di-tert-butylphenol) |
| 2,2-bis-(3,5-di-tert-butyl-4-hydroxyphenyl)-propane |
| 2,2'-bis-(methoxymethoxy)biphenyl |
| 2,2-di(3,5-di-tert-butyl-4-hydroxyphenyl)propane |
| 2,2'-di(2-methoxymethoxy)biphenyl |