1-phenothiazin-10-yl-2-(2,4,6-tribromophenoxy)ethanone structure
|
Common Name | 1-phenothiazin-10-yl-2-(2,4,6-tribromophenoxy)ethanone | ||
|---|---|---|---|---|
| CAS Number | 136776-26-6 | Molecular Weight | 570.09200 | |
| Density | 1.87g/cm3 | Boiling Point | 675.3ºC at 760mmHg | |
| Molecular Formula | C20H12Br3NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 362.2ºC | |
| Name | 1-phenothiazin-10-yl-2-(2,4,6-tribromophenoxy)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.87g/cm3 |
|---|---|
| Boiling Point | 675.3ºC at 760mmHg |
| Molecular Formula | C20H12Br3NO2S |
| Molecular Weight | 570.09200 |
| Flash Point | 362.2ºC |
| Exact Mass | 566.81400 |
| PSA | 54.84000 |
| LogP | 7.24740 |
| Vapour Pressure | 4.27E-18mmHg at 25°C |
| Index of Refraction | 1.712 |
| InChIKey | USEVHDSTHVJRQX-UHFFFAOYSA-N |
| SMILES | O=C(COc1c(Br)cc(Br)cc1Br)N1c2ccccc2Sc2ccccc21 |
|
~59%
1-phenothiazin-... CAS#:136776-26-6 |
| Literature: Chaurasia; Srivastava Journal of the Indian Chemical Society, 1991 , vol. 68, # 2 p. 106 - 107 |
|
~%
1-phenothiazin-... CAS#:136776-26-6 |
| Literature: Chaurasia; Srivastava Journal of the Indian Chemical Society, 1991 , vol. 68, # 2 p. 106 - 107 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 10H-Phenothiazine,10-((2,4,6-tribromophenoxy)acetyl) |
| 10-((2,4,6-Tribromophenoxy)acetyl)-10H-phenothiazine |