ethyl 2-amino-1,3-dihydroindene-2-carboxylate,hydrochloride
Modify Date: 2025-09-25 19:42:13
ethyl 2-amino-1,3-dihydroindene-2-carboxylate,hydrochloride structure
|
Common Name | ethyl 2-amino-1,3-dihydroindene-2-carboxylate,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 136834-79-2 | Molecular Weight | 241.71400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-amino-1,3-dihydroindene-2-carboxylate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16ClNO2 |
|---|---|
| Molecular Weight | 241.71400 |
| Exact Mass | 241.08700 |
| PSA | 52.32000 |
| LogP | 2.54810 |
| InChIKey | QBRJBPUVWWEAQV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(N)Cc2ccccc2C1.Cl |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| ETHYL 2-AMINO-2,3-DIHYDRO-1H-INDENE-2-CARBOXYLATE HCL |
| ethyl 2-amino-2,3-dihydro-1H-indene-2-carboxylate hydrochloride |