Pyridinium,2-methyl-1-(phenylmethyl)-, chloride (1:1) structure
|
Common Name | Pyridinium,2-methyl-1-(phenylmethyl)-, chloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 13686-87-8 | Molecular Weight | 219.71000 | |
| Density | 1.015g/cm3 | Boiling Point | 308.7ºC at 760 mmHg | |
| Molecular Formula | C13H14ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128ºC | |
| Name | 1-benzyl-2-methylpyridin-1-ium,chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.015g/cm3 |
|---|---|
| Boiling Point | 308.7ºC at 760 mmHg |
| Molecular Formula | C13H14ClN |
| Molecular Weight | 219.71000 |
| Flash Point | 128ºC |
| Exact Mass | 219.08100 |
| PSA | 3.88000 |
| Vapour Pressure | 0.00067mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | ASHVGNGFCXYXBN-UHFFFAOYSA-M |
| SMILES | Cc1cccc[n+]1Cc1ccccc1.[Cl-] |
| HS Code | 2933399090 |
|---|
|
~50%
Pyridinium,2-me... CAS#:13686-87-8 |
| Literature: Alvarez-Builla, J.; Trigo, G. Gonzales; Ezquerra, J.; Fombella, M.E. Journal of Heterocyclic Chemistry, 1985 , vol. 22, p. 681 - 685 |
|
~%
Pyridinium,2-me... CAS#:13686-87-8 |
| Literature: v. Walther; Weinhagen Journal fuer Praktische Chemie (Leipzig), 1917 , vol. <2> 96, p. 54 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| benzyl-|A-picolinium chloride |
| 1-Benzyl-2-methyl-pyridinium,Chlorid |
| 1-benzyl-2-picolinium chloride |
| 2-Picolinium,chloride |
| Benzyl-2-methylpyridinium chloride |
| 1-benzyl-2-methylpyridinium chloride |