4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl
Modify Date: 2025-11-06 07:42:09
4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl structure
|
Common Name | 4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl | ||
|---|---|---|---|---|
| CAS Number | 1369237-76-2 | Molecular Weight | 185.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H8FNO3 |
|---|---|
| Molecular Weight | 185.15 |
| InChIKey | MTTPSQRGDHWCKI-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)c(F)c(C)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl? |
| A: InChIKey of 4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl is MTTPSQRGDHWCKI-UHFFFAOYSA-N. |
| Q: What is the English name of 4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl? |
| A: The English name of 4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl is 4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl. |
| Q: What is the Chinese name of 1369237-76-2? |
| A: Chinese name of 1369237-76-2 is 1369237-76-2. |
| Q: What is the molecular weight of 4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl? |
| A: Molecular weight of 4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl is 185.15. |
| Q: What is the CAS number of 4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl? |
| A: CAS number of 4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl is 1369237-76-2. |
| Q: What is the SMILES notation of 4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl? |
| A: SMILES notation of 4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl is COc1cc(C(=O)O)c(F)c(C)n1. |
| Q: What is the molecular formula of 4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl? |
| A: Molecular formula of 4-Pyridinecarboxylic acid, 3-fluoro-6-methoxy-2-methyl is C8H8FNO3. |