E-Caffeic acid pentyl ester structure
|
Common Name | E-Caffeic acid pentyl ester | ||
|---|---|---|---|---|
| CAS Number | 136944-11-1 | Molecular Weight | 250.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | E-Caffeic acid pentyl ester |
|---|
| Molecular Formula | C14H18O4 |
|---|---|
| Molecular Weight | 250.29000 |
| Exact Mass | 250.12100 |
| PSA | 66.76000 |
| LogP | 2.84440 |
| InChIKey | ULPIXLKKVGJPCT-SOFGYWHQSA-N |
| SMILES | CCCCCOC(=O)C=Cc1ccc(O)c(O)c1 |
|
~%
E-Caffeic acid ... CAS#:136944-11-1 |
| Literature: Jayaprakasam, Bolleddula; Vanisree, Mulabagal; Zhang, Yanjun; Dewitt, David L.; Nair, Muraleedharan G. Journal of Agricultural and Food Chemistry, 2006 , vol. 54, # 15 p. 5375 - 5381 |