Delmadinone acetate
Delmadinone acetate structure
|
Common Name | Delmadinone acetate | ||
|---|---|---|---|---|
| CAS Number | 13698-49-2 | Molecular Weight | 402.91100 | |
| Density | 1.25 g/cm3 | Boiling Point | 519.5ºC at 760 mmHg | |
| Molecular Formula | C23H27ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.25 g/cm3 |
|---|---|
| Boiling Point | 519.5ºC at 760 mmHg |
| Molecular Formula | C23H27ClO4 |
| Molecular Weight | 402.91100 |
| Flash Point | 177.7ºC |
| Exact Mass | 402.16000 |
| PSA | 60.44000 |
| LogP | 4.52770 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | CGBCCZZJVKUAMX-DFXBJWIESA-N |
| SMILES | CC(=O)OC1(C(C)=O)CCC2C3C=C(Cl)C4=CC(=O)C=CC4(C)C3CCC21C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~89%
Delmadinone acetate CAS#:13698-49-2 |
| Literature: Shibata; Takegawa; Koizumi; Yamakoshi; Shimazawa Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 4 p. 935 - 941 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Tardastrex |
| 17-acetoxy-6-chlorpregna-1,4,6-triene-3,20-dione |
| 6-Chloro-17-hydroxypregna-1,4,6-triene-3,20-dione acetate |
| DELMADINONE ACETATE |
| RS-1301 |
| 17-acetoxy-6-chloro-pregna-1,4,6-triene-3,20-dione |
| 6-chloro-17-acetoxypregna-1,4,6-trien-3,20-dione |
| Zenadrex |
| Delminal |
| 17-Acetoxy-6-chlor-pregna-1,4,6-trien-3,20-dion |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate? |
| A: The English name of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate is [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate. |
| Q: What is the molecular formula of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate? |
| A: Molecular formula of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate is C23H27ClO4. |
| Q: What is the SMILES notation of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate? |
| A: SMILES notation of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate is CC(=O)OC1(C(C)=O)CCC2C3C=C(Cl)C4=CC(=O)C=CC4(C)C3CCC21C. |
| Q: What is the boiling point of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate? |
| A: Boiling point of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate is 519.5ºC at 760 mmHg. |
| Q: What is the molecular weight of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate? |
| A: Molecular weight of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate is 402.91100. |
| Q: What is the LogP of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate? |
| A: LogP of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate is 4.52770. |
| Q: What is the CAS number of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate? |
| A: CAS number of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate is 13698-49-2. |
| Q: What are the upstream materials of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate? |
| A: Related upstream materials(CAS) of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate: 302-22-7. |
| Q: What is the polar surface area (PSA) of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate? |
| A: Polar surface area (PSA) of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate is 60.44000. |
| Q: What is the InChIKey of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate? |
| A: InChIKey of [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate is CGBCCZZJVKUAMX-DFXBJWIESA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |