Delmadinone acetate structure
|
Common Name | Delmadinone acetate | ||
|---|---|---|---|---|
| CAS Number | 13698-49-2 | Molecular Weight | 402.91100 | |
| Density | 1.25 g/cm3 | Boiling Point | 519.5ºC at 760 mmHg | |
| Molecular Formula | C23H27ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.7ºC | |
| Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25 g/cm3 |
|---|---|
| Boiling Point | 519.5ºC at 760 mmHg |
| Molecular Formula | C23H27ClO4 |
| Molecular Weight | 402.91100 |
| Flash Point | 177.7ºC |
| Exact Mass | 402.16000 |
| PSA | 60.44000 |
| LogP | 4.52770 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | CGBCCZZJVKUAMX-DFXBJWIESA-N |
| SMILES | CC(=O)OC1(C(C)=O)CCC2C3C=C(Cl)C4=CC(=O)C=CC4(C)C3CCC21C |
|
~89%
Delmadinone acetate CAS#:13698-49-2 |
| Literature: Shibata; Takegawa; Koizumi; Yamakoshi; Shimazawa Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 4 p. 935 - 941 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Tardastrex |
| 17-acetoxy-6-chlorpregna-1,4,6-triene-3,20-dione |
| 6-Chloro-17-hydroxypregna-1,4,6-triene-3,20-dione acetate |
| DELMADINONE ACETATE |
| RS-1301 |
| 17-acetoxy-6-chloro-pregna-1,4,6-triene-3,20-dione |
| 6-chloro-17-acetoxypregna-1,4,6-trien-3,20-dione |
| Zenadrex |
| Delminal |
| 17-Acetoxy-6-chlor-pregna-1,4,6-trien-3,20-dion |