Thiamine beta-hydroxyethyl disulfide
Modify Date: 2025-09-22 16:33:41
Thiamine beta-hydroxyethyl disulfide structure
|
Common Name | Thiamine beta-hydroxyethyl disulfide | ||
|---|---|---|---|---|
| CAS Number | 137-85-9 | Molecular Weight | 358.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22N4O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Thiamine beta-hydroxyethyl disulfide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H22N4O3S2 |
|---|---|
| Molecular Weight | 358.5 |
| InChIKey | RAQQRQCODVNJCK-JLHYYAGUSA-N |
| SMILES | CC(=C(CCO)SSCCO)N(C=O)Cc1cnc(C)nc1N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Thiamine beta-hydroxyethyl disulfide? |
| A: InChIKey of Thiamine beta-hydroxyethyl disulfide is RAQQRQCODVNJCK-JLHYYAGUSA-N. |
| Q: What is the Chinese name of 137-85-9? |
| A: Chinese name of 137-85-9 is 137-85-9. |
| Q: What is the molecular formula of Thiamine beta-hydroxyethyl disulfide? |
| A: Molecular formula of Thiamine beta-hydroxyethyl disulfide is C14H22N4O3S2. |
| Q: What is the molecular weight of Thiamine beta-hydroxyethyl disulfide? |
| A: Molecular weight of Thiamine beta-hydroxyethyl disulfide is 358.5. |
| Q: What is the CAS number of Thiamine beta-hydroxyethyl disulfide? |
| A: CAS number of Thiamine beta-hydroxyethyl disulfide is 137-85-9. |
| Q: What is the English name of Thiamine beta-hydroxyethyl disulfide? |
| A: The English name of Thiamine beta-hydroxyethyl disulfide is Thiamine beta-hydroxyethyl disulfide. |
| Q: What is the SMILES notation of Thiamine beta-hydroxyethyl disulfide? |
| A: SMILES notation of Thiamine beta-hydroxyethyl disulfide is CC(=C(CCO)SSCCO)N(C=O)Cc1cnc(C)nc1N. |